Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Phenyl sulfide, 99%
CAS: 139-66-2 Molecular Formula: C12H10S Molecular Weight (g/mol): 186.27 MDL Number: MFCD00003064 InChI Key: LTYMSROWYAPPGB-UHFFFAOYSA-N Synonym: diphenyl sulfide,phenyl sulfide,phenylthiobenzene,diphenyl sulphide,diphenyl thioether,benzene, 1,1'-thiobis,diphenylmercaptan,diphenylthiamethane,diphenyl monosulfide,sulfide, diphenyl PubChem CID: 8766 ChEBI: CHEBI:38959 IUPAC Name: phenylsulfanylbenzene SMILES: S(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 8766 |
|---|---|
| CAS | 139-66-2 |
| Molecular Weight (g/mol) | 186.27 |
| ChEBI | CHEBI:38959 |
| MDL Number | MFCD00003064 |
| SMILES | S(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyl sulfide,phenyl sulfide,phenylthiobenzene,diphenyl sulphide,diphenyl thioether,benzene, 1,1'-thiobis,diphenylmercaptan,diphenylthiamethane,diphenyl monosulfide,sulfide, diphenyl |
| IUPAC Name | phenylsulfanylbenzene |
| InChI Key | LTYMSROWYAPPGB-UHFFFAOYSA-N |
| Molecular Formula | C12H10S |
Phenanthrene, 97%
CAS: 85-01-8 Molecular Formula: C14H10 Molecular Weight (g/mol): 178.23 MDL Number: MFCD00001168 InChI Key: YNPNZTXNASCQKK-UHFFFAOYSA-N Synonym: phenanthren,phenanthrin,phenanthracene,ravatite,phenantrin,phenanthren german,phenanthrene, pure,unii-448j8e5bst,ccris 1233,chembl46730 PubChem CID: 995 ChEBI: CHEBI:28851 IUPAC Name: phenanthrene SMILES: C1=CC=C2C(C=CC3=CC=CC=C23)=C1
| PubChem CID | 995 |
|---|---|
| CAS | 85-01-8 |
| Molecular Weight (g/mol) | 178.23 |
| ChEBI | CHEBI:28851 |
| MDL Number | MFCD00001168 |
| SMILES | C1=CC=C2C(C=CC3=CC=CC=C23)=C1 |
| Synonym | phenanthren,phenanthrin,phenanthracene,ravatite,phenantrin,phenanthren german,phenanthrene, pure,unii-448j8e5bst,ccris 1233,chembl46730 |
| IUPAC Name | phenanthrene |
| InChI Key | YNPNZTXNASCQKK-UHFFFAOYSA-N |
| Molecular Formula | C14H10 |
Compound 48/80, MP Biomedicals™
CAS: 94724-12-6 Molecular Formula: C32H48Cl3N3O3 Molecular Weight (g/mol): 629.104 InChI Key: KIAWAQJORBNOIF-UHFFFAOYSA-N Synonym: compound 48/80 trihydrochloride PubChem CID: 118797323 IUPAC Name: 2-[4-methoxy-3-[[2-methoxy-3-[[2-methoxy-5-[2-(methylamino)ethyl]phenyl]methyl]-5-[2-(methylamino)ethyl]phenyl]methyl]phenyl]-N-methylethanamine;trihydrochloride SMILES: CNCCC1=CC(=C(C=C1)OC)CC2=CC(=CC(=C2OC)CC3=C(C=CC(=C3)CCNC)OC)CCNC.Cl.Cl.Cl
| PubChem CID | 118797323 |
|---|---|
| CAS | 94724-12-6 |
| Molecular Weight (g/mol) | 629.104 |
| SMILES | CNCCC1=CC(=C(C=C1)OC)CC2=CC(=CC(=C2OC)CC3=C(C=CC(=C3)CCNC)OC)CCNC.Cl.Cl.Cl |
| Synonym | compound 48/80 trihydrochloride |
| IUPAC Name | 2-[4-methoxy-3-[[2-methoxy-3-[[2-methoxy-5-[2-(methylamino)ethyl]phenyl]methyl]-5-[2-(methylamino)ethyl]phenyl]methyl]phenyl]-N-methylethanamine;trihydrochloride |
| InChI Key | KIAWAQJORBNOIF-UHFFFAOYSA-N |
| Molecular Formula | C32H48Cl3N3O3 |
D-(+)-Galactosamine hydrochloride, 99%, MP Biomedicals™
CAS: 1772-03-8 Molecular Formula: C6H13NO5·HCl Synonym: Chondrosamine hydrochloride,2-Amino-2-deoxy-D-galactopyranose hydrochloride
| CAS | 1772-03-8 |
|---|---|
| Synonym | Chondrosamine hydrochloride,2-Amino-2-deoxy-D-galactopyranose hydrochloride |
| Molecular Formula | C6H13NO5·HCl |
Pentane, HPLC Grade, J.T. Baker™
CAS: 109-66-0 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009498 InChI Key: OFBQJSOFQDEBGM-UHFFFAOYSA-N Synonym: n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish PubChem CID: 8003 ChEBI: CHEBI:37830 IUPAC Name: pentane SMILES: CCCCC
| PubChem CID | 8003 |
|---|---|
| CAS | 109-66-0 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:37830 |
| MDL Number | MFCD00009498 |
| SMILES | CCCCC |
| Synonym | n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish |
| IUPAC Name | pentane |
| InChI Key | OFBQJSOFQDEBGM-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
1-Iodonaphthalene, 97.5%
CAS: 90-14-2 Molecular Formula: C10H7I Molecular Weight (g/mol): 254.07 MDL Number: MFCD00003876 InChI Key: NHPPIJMARIVBGU-UHFFFAOYSA-N Synonym: naphthalene, 1-iodo,1-naphthyl iodide,alpha-iodonaphthalene,iodonaphthalene,1-iodonaphthalenen,.alpha.-iodonaphthalene,1-iodo-naphthalene,1-iodonaphthlen,1-iodonaphthlene,1-iodonapthalene PubChem CID: 7004 IUPAC Name: 1-iodonaphthalene SMILES: C1=CC=C2C(=C1)C=CC=C2I
| PubChem CID | 7004 |
|---|---|
| CAS | 90-14-2 |
| Molecular Weight (g/mol) | 254.07 |
| MDL Number | MFCD00003876 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2I |
| Synonym | naphthalene, 1-iodo,1-naphthyl iodide,alpha-iodonaphthalene,iodonaphthalene,1-iodonaphthalenen,.alpha.-iodonaphthalene,1-iodo-naphthalene,1-iodonaphthlen,1-iodonaphthlene,1-iodonapthalene |
| IUPAC Name | 1-iodonaphthalene |
| InChI Key | NHPPIJMARIVBGU-UHFFFAOYSA-N |
| Molecular Formula | C10H7I |
| CAS | 7440-44-0 |
|---|
| CAS | 518-67-2 |
|---|
Dipropylene Glycol, 99%, Spectrum™ Chemical
CAS: 25265-71-8 Molecular Formula: C6H14O3 Molecular Weight (g/mol): 134.18 InChI Key: QYSXYAURTRCDJU-UHFFFAOYNA-N IUPAC Name: 1-(1-hydroxypropoxy)propan-1-ol SMILES: CCC(O)OC(O)CC
| CAS | 25265-71-8 |
|---|---|
| Molecular Weight (g/mol) | 134.18 |
| SMILES | CCC(O)OC(O)CC |
| IUPAC Name | 1-(1-hydroxypropoxy)propan-1-ol |
| InChI Key | QYSXYAURTRCDJU-UHFFFAOYNA-N |
| Molecular Formula | C6H14O3 |
| CAS | 85-01-8 |
|---|
3-Isobutyl-1-methylxanthine
CAS: 28822-58-4 Molecular Formula: C10H14N4O2 Molecular Weight (g/mol): 222.25 MDL Number: MFCD00005584 InChI Key: APIXJSLKIYYUKG-UHFFFAOYSA-N Synonym: 3-isobutyl-1-methylxanthine,ibmx,isobutylmethylxanthine,1-methyl-3-isobutylxanthine,methylisobutylxanthine,3-isobutyl-1-methyl-1h-purine-2,6 3h,7h-dione,xanthine, 3-isobutyl-1-methyl,3-isobutyl-1-methyxanthine,1h-purine-2,6-dione, 3,7-dihydro-1-methyl-3-2-methylpropyl,methyl-isobutylxanthine PubChem CID: 3758 ChEBI: CHEBI:43253 IUPAC Name: 1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione SMILES: CC(C)CN1C2=C(NC=N2)C(=O)N(C)C1=O
| PubChem CID | 3758 |
|---|---|
| CAS | 28822-58-4 |
| Molecular Weight (g/mol) | 222.25 |
| ChEBI | CHEBI:43253 |
| MDL Number | MFCD00005584 |
| SMILES | CC(C)CN1C2=C(NC=N2)C(=O)N(C)C1=O |
| Synonym | 3-isobutyl-1-methylxanthine,ibmx,isobutylmethylxanthine,1-methyl-3-isobutylxanthine,methylisobutylxanthine,3-isobutyl-1-methyl-1h-purine-2,6 3h,7h-dione,xanthine, 3-isobutyl-1-methyl,3-isobutyl-1-methyxanthine,1h-purine-2,6-dione, 3,7-dihydro-1-methyl-3-2-methylpropyl,methyl-isobutylxanthine |
| IUPAC Name | 1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione |
| InChI Key | APIXJSLKIYYUKG-UHFFFAOYSA-N |
| Molecular Formula | C10H14N4O2 |
Zinc trifluoromethanesulfonate, 98%
CAS: 54010-75-2 Molecular Formula: C2F6O6S2Zn Molecular Weight (g/mol): 363.51 MDL Number: MFCD00013229 InChI Key: CITILBVTAYEWKR-UHFFFAOYSA-L Synonym: zinc trifluoromethanesulfonate,zinc ii trifluoromethanesulfonate,zinc trifluoromethanesulphonate,zinc triflate,zinc ii triflate,zn otf 2,methanesulfonic acid, trifluoro-, zinc salt,zinc 2+ ion ditriflate,methanesulfonic acid, 1,1,1-trifluoro-, zinc salt 2:1,zinc ii trifluoromethanesulphonate PubChem CID: 104671 SMILES: [Zn++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F
| PubChem CID | 104671 |
|---|---|
| CAS | 54010-75-2 |
| Molecular Weight (g/mol) | 363.51 |
| MDL Number | MFCD00013229 |
| SMILES | [Zn++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| Synonym | zinc trifluoromethanesulfonate,zinc ii trifluoromethanesulfonate,zinc trifluoromethanesulphonate,zinc triflate,zinc ii triflate,zn otf 2,methanesulfonic acid, trifluoro-, zinc salt,zinc 2+ ion ditriflate,methanesulfonic acid, 1,1,1-trifluoro-, zinc salt 2:1,zinc ii trifluoromethanesulphonate |
| InChI Key | CITILBVTAYEWKR-UHFFFAOYSA-L |
| Molecular Formula | C2F6O6S2Zn |
Benzyltriethylammonium chloride, 98%
CAS: 56-37-1 Molecular Formula: C13H22ClN Molecular Weight (g/mol): 227.78 MDL Number: MFCD00011824 InChI Key: HTZCNXWZYVXIMZ-UHFFFAOYSA-M Synonym: benzyltriethylammonium chloride,tebac,benzyl triethylammonium chloride,benzyl triethyl ammonium chloride,benzyltriethylammoniumchloride,triethylbenzylammonium chloride,bteac,teba,benzyltriethylazanium chloride,n-benzyl-n,n-diethylethanaminium chloride PubChem CID: 66133 IUPAC Name: benzyl(triethyl)azanium;chloride SMILES: [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1
| PubChem CID | 66133 |
|---|---|
| CAS | 56-37-1 |
| Molecular Weight (g/mol) | 227.78 |
| MDL Number | MFCD00011824 |
| SMILES | [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 |
| Synonym | benzyltriethylammonium chloride,tebac,benzyl triethylammonium chloride,benzyl triethyl ammonium chloride,benzyltriethylammoniumchloride,triethylbenzylammonium chloride,bteac,teba,benzyltriethylazanium chloride,n-benzyl-n,n-diethylethanaminium chloride |
| IUPAC Name | benzyl(triethyl)azanium;chloride |
| InChI Key | HTZCNXWZYVXIMZ-UHFFFAOYSA-M |
| Molecular Formula | C13H22ClN |
3-Bromotoluene, 98%, Thermo Scientific Chemicals
CAS: 591-17-3 Molecular Formula: C7H7Br Molecular Weight (g/mol): 171.04 MDL Number: MFCD00000085 InChI Key: WJIFKOVZNJTSGO-UHFFFAOYSA-N Synonym: 3-bromotoluene,m-bromotoluene,3-methylbromobenzene,benzene, 1-bromo-3-methyl,m-tolyl bromide,toluene, m-bromo,5-bromotoluene,3-bromo-1-methylbenzene,m-methylbromobenzene,3-methyl-1-bromobenzene PubChem CID: 11560 IUPAC Name: 1-bromo-3-methylbenzene SMILES: CC1=CC=CC(Br)=C1
| PubChem CID | 11560 |
|---|---|
| CAS | 591-17-3 |
| Molecular Weight (g/mol) | 171.04 |
| MDL Number | MFCD00000085 |
| SMILES | CC1=CC=CC(Br)=C1 |
| Synonym | 3-bromotoluene,m-bromotoluene,3-methylbromobenzene,benzene, 1-bromo-3-methyl,m-tolyl bromide,toluene, m-bromo,5-bromotoluene,3-bromo-1-methylbenzene,m-methylbromobenzene,3-methyl-1-bromobenzene |
| IUPAC Name | 1-bromo-3-methylbenzene |
| InChI Key | WJIFKOVZNJTSGO-UHFFFAOYSA-N |
| Molecular Formula | C7H7Br |
Dimethyl isophthalate, 99%
CAS: 1459-93-4 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00008433 InChI Key: VNGOYPQMJFJDLV-UHFFFAOYSA-N Synonym: dimethyl isophthalate,dimethyl m-phthalate,isophthalic acid dimethyl ester,methyl isophthalate,1,3-benzenedicarboxylic acid, dimethyl ester,morflex 1129,dimethyl 1,3-benzenedicarboxylate,dimethylisophthalate,methyl 3-carbomethoxy benzoate,isophthalic acid, dimethyl ester PubChem CID: 15088 IUPAC Name: dimethyl benzene-1,3-dicarboxylate SMILES: COC(=O)C1=CC(=CC=C1)C(=O)OC
| PubChem CID | 15088 |
|---|---|
| CAS | 1459-93-4 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00008433 |
| SMILES | COC(=O)C1=CC(=CC=C1)C(=O)OC |
| Synonym | dimethyl isophthalate,dimethyl m-phthalate,isophthalic acid dimethyl ester,methyl isophthalate,1,3-benzenedicarboxylic acid, dimethyl ester,morflex 1129,dimethyl 1,3-benzenedicarboxylate,dimethylisophthalate,methyl 3-carbomethoxy benzoate,isophthalic acid, dimethyl ester |
| IUPAC Name | dimethyl benzene-1,3-dicarboxylate |
| InChI Key | VNGOYPQMJFJDLV-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |